2-(4-Methylphenoxy)propylamine

• Catalog Number: ACMA00001999
• Category: Ethers
• Molecular Weight: 165.23
• Molecular Formula: C₁₀H₁₄O₄
• Hazard Statements: H318
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS05

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C10H15NO.

What is the molecular weight of the compound?

The molecular weight is 165.23 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 2-(4-methylphenoxy)propan-1-amine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C10H15NO/c1-8-3-5-10(6-4-8)12-9(2)7-11/h3-6,9H,7,11H2,1-2H3.

What is the InChIKey of the compound?

The InChIKey is UFSYYRNCFQQPQC-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is CC1=CC=C(C=C1)OC(C)CN.

What is the CAS number of the compound?

The CAS number is 6440-97-7.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is 1.7.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 2 hydrogen bond acceptor counts.