CAS
--- Purity
---
--- Purity
---
Inquiry Basket
2-(4-Methoxyphenoxy)ethanimidamide hydrochloride
Catalog Number
ACMA00002845
Category
Ethers
Molecular Weight
216.66
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302-H318
RIDADR
UN 2735PSN1 8 / PGII
Symbol
GHS05
What is the molecular formula of the compound?
The molecular formula of the compound is C9H13ClN2O2.
What is the molecular weight of the compound?
The molecular weight of the compound is 216.66 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-(4-methoxyphenoxy)ethanimidamide hydrochloride.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H12N2O2.ClH/c1-12-7-2-4-8(5-3-7)13-6-9(10)11;/h2-5H,6H2,1H3,(H3,10,11);1H.
What is the InChIKey of the compound?
The InChIKey of the compound is VCJGAACYPNNQAV-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is COC1=CC=C(C=C1)OCC(=N)N.Cl.
How many hydrogen bond donor counts does the compound have?
The compound has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 4 rotatable bond counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 68.3Ų.
Recommended Products
