2-(4-Formylphenoxy)butanoic acid

• Catalog Number: ACMA00002172
• Category: Ethers
• Molecular Weight: 208.21
• Molecular Formula: C₁₁H₁₂O₃
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-(4-Formylphenoxy)butanoic acid?

The molecular formula is C11H12O4.

What is the molecular weight of 2-(4-Formylphenoxy)butanoic acid?

The molecular weight is 208.21 g/mol.

What is the IUPAC name of 2-(4-Formylphenoxy)butanoic acid?

The IUPAC name is 2-(4-formylphenoxy)butanoic acid.

What is the InChI of 2-(4-Formylphenoxy)butanoic acid?

The InChI is InChI=1S/C11H12O4/c1-2-10(11(13)14)15-9-5-3-8(7-12)4-6-9/h3-7,10H,2H2,1H3,(H,13,14).

What is the InChIKey of 2-(4-Formylphenoxy)butanoic acid?

The InChIKey is NDEBXGQJHIQFSU-UHFFFAOYSA-N.

What is the canonical SMILES of 2-(4-Formylphenoxy)butanoic acid?

The canonical SMILES is CCC(C(=O)O)OC1=CC=C(C=C1)C=O.

What is the XLogP3-AA value of 2-(4-Formylphenoxy)butanoic acid?

The XLogP3-AA value is 1.9.

How many hydrogen bond donor counts does 2-(4-Formylphenoxy)butanoic acid have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 2-(4-Formylphenoxy)butanoic acid have?

It has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does 2-(4-Formylphenoxy)butanoic acid have?

It has 5 rotatable bond counts.