CAS
24564-77-0 Purity
---
24564-77-0 Purity
---
Inquiry Basket
2,4-Dihydroxyheptadec-16-enyl acetate
CAS
24607-09-8
Catalog Number
ACM24607098
Category
Other Products
Molecular Weight
0
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
2,4-dihydroxyheptadec-16-enyl acetate
Supplemental Hazard Statements
H413
What is the molecular formula of 2,4-dihydroxyheptadec-16-enyl acetate?
The molecular formula is C19H36O4.
What is the molecular weight of 2,4-dihydroxyheptadec-16-enyl acetate?
The molecular weight is 328.5 g/mol.
What is the IUPAC name of 2,4-dihydroxyheptadec-16-enyl acetate?
The IUPAC name is 2,4-dihydroxyheptadec-16-enyl acetate.
What is the InChI of 2,4-dihydroxyheptadec-16-enyl acetate?
The InChI is InChI=1S/C19H36O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-18(21)15-19(22)16-23-17(2)20/h3,18-19,21-22H,1,4-16H2,2H3.
How many hydrogen bond donor counts does 2,4-dihydroxyheptadec-16-enyl acetate have?
It has 2 hydrogen bond donor counts.
What is the XLogP3-AA value of 2,4-dihydroxyheptadec-16-enyl acetate?
The XLogP3-AA value is 5.4.
What is the topological polar surface area of 2,4-dihydroxyheptadec-16-enyl acetate?
The topological polar surface area is 66.8 Ų.
How many rotatable bond counts does 2,4-dihydroxyheptadec-16-enyl acetate have?
It has 17 rotatable bond counts.
Is 2,4-dihydroxyheptadec-16-enyl acetate a canonicalized compound?
Yes, it is a canonicalized compound.
What is the ChEMBL ID of 2,4-dihydroxyheptadec-16-enyl acetate?
The ChEMBL ID is CHEMBL1443413.
Recommended Products
