2,4-Difluorobenzenesulfonyl chloride

• CAS: 13918-92-8
• Catalog Number: ACM13918928
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 212.60
• Hazard Statements: H302-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2,4-Difluorobenzenesulfonyl chloride?

The molecular formula of 2,4-Difluorobenzenesulfonyl chloride is C6H3ClF2O2S.

What is the molecular weight of 2,4-Difluorobenzenesulfonyl chloride?

The molecular weight of 2,4-Difluorobenzenesulfonyl chloride is 212.60 g/mol.

What is the IUPAC name of 2,4-Difluorobenzenesulfonyl chloride?

The IUPAC name of 2,4-Difluorobenzenesulfonyl chloride is 2,4-difluorobenzenesulfonyl chloride.

What is the Canonical SMILES representation of 2,4-Difluorobenzenesulfonyl chloride?

The Canonical SMILES representation of 2,4-Difluorobenzenesulfonyl chloride is C1=CC(=C(C=C1F)F)S(=O)(=O)Cl.

What is the InChIKey of 2,4-Difluorobenzenesulfonyl chloride?

The InChIKey of 2,4-Difluorobenzenesulfonyl chloride is FJSAJUXIHJIAMD-UHFFFAOYSA-N.

What is the XLogP3-AA value of 2,4-Difluorobenzenesulfonyl chloride?

The XLogP3-AA value of 2,4-Difluorobenzenesulfonyl chloride is 2.1.

How many hydrogen bond donor count does 2,4-Difluorobenzenesulfonyl chloride have?

2,4-Difluorobenzenesulfonyl chloride has 0 hydrogen bond donor count.

How many hydrogen bond acceptor count does 2,4-Difluorobenzenesulfonyl chloride have?

2,4-Difluorobenzenesulfonyl chloride has 4 hydrogen bond acceptor count.

What is the topological polar surface area of 2,4-Difluorobenzenesulfonyl chloride?

The topological polar surface area of 2,4-Difluorobenzenesulfonyl chloride is 42.5 Å^2.

Is 2,4-Difluorobenzenesulfonyl chloride considered as a canonicalized compound?

Yes, 2,4-Difluorobenzenesulfonyl chloride is considered as a canonicalized compound.