2,4-Dibromo-5-fluoro-3-nitropyridine

• CAS: 884494-91-1
• Catalog Number: ACM884494911
• Category: Bromine Series
• Molecular Weight: 299.88
• Molecular Formula: C₅HBr₂FN₂O₂
• Synonyms: 2,4-DIBROMO-5-FLUORO-3-NITROPYRIDINE

Custom Q&A

What is the molecular formula of 2,4-Dibromo-5-fluoro-3-nitropyridine?

The molecular formula of 2,4-Dibromo-5-fluoro-3-nitropyridine is C5HBr2FN2O2.

What is the molecular weight of 2,4-Dibromo-5-fluoro-3-nitropyridine?

The molecular weight of 2,4-Dibromo-5-fluoro-3-nitropyridine is 299.88 g/mol.

What is the IUPAC name of 2,4-Dibromo-5-fluoro-3-nitropyridine?

The IUPAC name of 2,4-Dibromo-5-fluoro-3-nitropyridine is 2,4-dibromo-5-fluoro-3-nitropyridine.

What is the InChI of 2,4-Dibromo-5-fluoro-3-nitropyridine?

The InChI of 2,4-Dibromo-5-fluoro-3-nitropyridine is InChI=1S/C5HBr2FN2O2/c6-3-2(8)1-9-5(7)4(3)10(11)12/h1H.

What is the InChIKey of 2,4-Dibromo-5-fluoro-3-nitropyridine?

The InChIKey of 2,4-Dibromo-5-fluoro-3-nitropyridine is RUKHOWBZNXYATH-UHFFFAOYSA-N.

What is the canonical SMILES representation of 2,4-Dibromo-5-fluoro-3-nitropyridine?

The canonical SMILES representation of 2,4-Dibromo-5-fluoro-3-nitropyridine is C1=C(C(=C(C(=N1)Br)[N+](=O)[O-])Br)F.

What is the CAS number of 2,4-Dibromo-5-fluoro-3-nitropyridine?

The CAS number of 2,4-Dibromo-5-fluoro-3-nitropyridine is 884494-91-1.

What is the XLogP3-AA value of 2,4-Dibromo-5-fluoro-3-nitropyridine?

The XLogP3-AA value of 2,4-Dibromo-5-fluoro-3-nitropyridine is 2.5.

How many hydrogen bond acceptor counts does 2,4-Dibromo-5-fluoro-3-nitropyridine have?

2,4-Dibromo-5-fluoro-3-nitropyridine has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does 2,4-Dibromo-5-fluoro-3-nitropyridine have?

2,4-Dibromo-5-fluoro-3-nitropyridine has 0 rotatable bond counts.