2,4,6-Tris(bromomethyl)mesitylene

• CAS: 21988-87-4
• Catalog Number: ACM21988874
• Category: Aryl
• Molecular Weight: 398.96
• Molecular Formula: C₁₂H₁₅Br₃
• Hazard Statements: H302-H315-H318-H335-H400
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the IUPAC name of the compound 2,4,6-Tris(bromomethyl)mesitylene?

The IUPAC name of the compound is 1,3,5-tris(bromomethyl)-2,4,6-trimethylbenzene.

What is the molecular formula of 2,4,6-Tris(bromomethyl)mesitylene?

The molecular formula is C12H15Br3.

What is the molecular weight of 2,4,6-Tris(bromomethyl)mesitylene?

The molecular weight is 398.96 g/mol.

What is the CAS number of 2,4,6-Tris(bromomethyl)mesitylene?

The CAS number is 21988-87-4.

What is the InChI of 2,4,6-Tris(bromomethyl)mesitylene?

The InChI is InChI=1S/C12H15Br3/c1-7-10(4-13)8(2)12(6-15)9(3)11(7)5-14/h4-6H2,1-3H3.

What is the Canonical SMILES of 2,4,6-Tris(bromomethyl)mesitylene?

The Canonical SMILES is CC1=C(C(=C(C(=C1CBr)C)CBr)C)CBr.

What is the XLogP3-AA value of 2,4,6-Tris(bromomethyl)mesitylene?

The XLogP3-AA value is 4.7.

How many rotatable bonds does 2,4,6-Tris(bromomethyl)mesitylene have?

It has 3 rotatable bonds.

What is the topological polar surface area of 2,4,6-Tris(bromomethyl)mesitylene?

The topological polar surface area is 0Ų.

Is 2,4,6-Tris(bromomethyl)mesitylene a canonicalized compound?

Yes, it is a canonicalized compound.