--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 2-(3-fluoro-4-methoxyphenyl)acetamide.
The InChI of the compound is InChI=1S/C9H10FNO2/c1-13-8-3-2-6(4-7(8)10)5-9(11)12/h2-4H,5H2,1H3,(H2,11,12).
The InChIKey of the compound is DGWHYCIOECGKKS-UHFFFAOYSA-N.
The Canonical SMILES of the compound is COC1=C(C=C(C=C1)CC(=O)N)F.
The molecular weight of the compound is 183.18 g/mol.
The XLogP3 value of the compound is 0.4.
The compound has 1 hydrogen bond donor count.
The compound has 3 hydrogen bond acceptor counts.
The exact mass of the compound is 183.06955672 g/mol.
Yes, the compound is canonicalized.