What is the molecular formula of 2,3-Difluoro-4-methylbenzoyl chloride?
The molecular formula is C8H5ClF2O.
When was 2,3-Difluoro-4-methylbenzoyl chloride created and last modified?
It was created on 2005-07-19 and last modified on 2023-12-23.
What is the IUPAC name of 2,3-Difluoro-4-methylbenzoyl chloride?
The IUPAC name is 2,3-difluoro-4-methylbenzoyl chloride.
What is the InChIKey of 2,3-Difluoro-4-methylbenzoyl chloride?
The InChIKey is IHRMSSGDXMQPBA-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 2,3-Difluoro-4-methylbenzoyl chloride?
The Canonical SMILES is CC1=C(C(=C(C=C1)C(=O)Cl)F)F.
What is the CAS number of 2,3-Difluoro-4-methylbenzoyl chloride?
The CAS number is 261763-38-6.
What is the molecular weight of 2,3-Difluoro-4-methylbenzoyl chloride?
The molecular weight is 190.57 g/mol.
How many hydrogen bond acceptor counts does 2,3-Difluoro-4-methylbenzoyl chloride have?
It has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of 2,3-Difluoro-4-methylbenzoyl chloride?
The topological polar surface area is 17.1 Ų.
Is 2,3-Difluoro-4-methylbenzoyl chloride in canonical form?
Yes, the compound is canonicalized according to PubChem.