2,3-Difluoro-4-methoxyphenylboronic acid

• CAS: 170981-41-6
• Catalog Number: ACM170981416
• Category: Boronic Acids
• Molecular Formula: C₇H₇BF₂O₃
• Synonyms: 2,3-Difluoroanisylboronic acid;4-Borono-2,3-difluoroanisole;2,3-Difluoro-4-methoxyphenylboronic aicd

Custom Q&A

What is the molecular formula of 2,3-Difluoro-4-methoxyphenylboronic acid?

The molecular formula of 2,3-Difluoro-4-methoxyphenylboronic acid is C7H7BF2O3.

What is the molecular weight of 2,3-Difluoro-4-methoxyphenylboronic acid?

The molecular weight of 2,3-Difluoro-4-methoxyphenylboronic acid is 187.94 g/mol.

When was 2,3-Difluoro-4-methoxyphenylboronic acid created?

2,3-Difluoro-4-methoxyphenylboronic acid was created on December 1, 2008.

What is the IUPAC name of 2,3-Difluoro-4-methoxyphenylboronic acid?

The IUPAC name of 2,3-Difluoro-4-methoxyphenylboronic acid is (2,3-difluoro-4-methoxyphenyl)boronic acid.

What is the InChI of 2,3-Difluoro-4-methoxyphenylboronic acid?

The InChI of 2,3-Difluoro-4-methoxyphenylboronic acid is InChI=1S/C7H7BF2O3/c1-13-5-3-2-4(8(11)12)6(9)7(5)10/h2-3,11-12H,1H3.

What is the InChIKey of 2,3-Difluoro-4-methoxyphenylboronic acid?

The InChIKey of 2,3-Difluoro-4-methoxyphenylboronic acid is HIWYFMBSFSTYGU-UHFFFAOYSA-N.

What is the canonical SMILES of 2,3-Difluoro-4-methoxyphenylboronic acid?

The canonical SMILES of 2,3-Difluoro-4-methoxyphenylboronic acid is B(C1=C(C(=C(C=C1)OC)F)F)(O)O.

What is the CAS number of 2,3-Difluoro-4-methoxyphenylboronic acid?

The CAS number of 2,3-Difluoro-4-methoxyphenylboronic acid is 170981-41-6.

What is the European Community (EC) number of 2,3-Difluoro-4-methoxyphenylboronic acid?

The European Community (EC) number of 2,3-Difluoro-4-methoxyphenylboronic acid is 800-548-8.

What is the topological polar surface area of 2,3-Difluoro-4-methoxyphenylboronic acid?

The topological polar surface area of 2,3-Difluoro-4-methoxyphenylboronic acid is 49.7Ų.