2-(3-Aminophenoxy)ethanol

• CAS: 50963-77-4
• Catalog Number: ACM50963774-1
• Category: Ethers
• Molecular Weight: 153.18
• Molecular Formula: C₈H₁₀N₂O₂
• Hazard Statements: H226
• Symbol: GHS02

Custom Q&A

What is the molecular formula of 2-(3-aminophenoxy)ethanol?

The molecular formula of 2-(3-aminophenoxy)ethanol is C8H11NO2.

What is the molecular weight of 2-(3-aminophenoxy)ethanol?

The molecular weight of 2-(3-aminophenoxy)ethanol is 153.18 g/mol.

What is the IUPAC name of 2-(3-aminophenoxy)ethanol?

The IUPAC name of 2-(3-aminophenoxy)ethanol is 2-(3-aminophenoxy)ethanol.

What is the InChI of 2-(3-aminophenoxy)ethanol?

The InChI of 2-(3-aminophenoxy)ethanol is InChI=1S/C8H11NO2/c9-7-2-1-3-8(6-7)11-5-4-10/h1-3,6,10H,4-5,9H2.

What is the InChIKey of 2-(3-aminophenoxy)ethanol?

The InChIKey of 2-(3-aminophenoxy)ethanol is PRMZVGDZZPRZIF-UHFFFAOYSA-N.

What is the canonical SMILES of 2-(3-aminophenoxy)ethanol?

The canonical SMILES of 2-(3-aminophenoxy)ethanol is C1=CC(=CC(=C1)OCCO)N.

What is the CAS number of 2-(3-aminophenoxy)ethanol?

The CAS number of 2-(3-aminophenoxy)ethanol is 50963-77-4.

What is the XLogP3 value of 2-(3-aminophenoxy)ethanol?

The XLogP3 value of 2-(3-aminophenoxy)ethanol is 0.2.

How many hydrogen bond donor counts does 2-(3-aminophenoxy)ethanol have?

2-(3-aminophenoxy)ethanol has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2-(3-aminophenoxy)ethanol have?

2-(3-aminophenoxy)ethanol has 3 hydrogen bond acceptor counts.