2,3,4-Trifluorobenzoic acid

• CAS: 61079-72-9
• Catalog Number: ACM61079729
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 176.09
• Hazard Statements: H315-H319-H335
• RIDADR: UN 3265 8 / PGII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2,3,4-Trifluorobenzoic acid?

The molecular formula of 2,3,4-Trifluorobenzoic acid is C7H3F3O2.

When was 2,3,4-Trifluorobenzoic acid created in PubChem?

2,3,4-Trifluorobenzoic acid was created in PubChem on March 26, 2005.

What is the molecular weight of 2,3,4-Trifluorobenzoic acid?

The molecular weight of 2,3,4-Trifluorobenzoic acid is 176.09 g/mol.

What is the Canonical SMILES for 2,3,4-Trifluorobenzoic acid?

The Canonical SMILES for 2,3,4-Trifluorobenzoic acid is C1=CC(=C(C(=C1C(=O)O)F)F)F.

What is the InChIKey for 2,3,4-Trifluorobenzoic acid?

The InChIKey for 2,3,4-Trifluorobenzoic acid is WEPXLRANFJEOFZ-UHFFFAOYSA-N.

How many hydrogen bond donor counts does 2,3,4-Trifluorobenzoic acid have?

2,3,4-Trifluorobenzoic acid has 1 hydrogen bond donor count.

What is the exact mass of 2,3,4-Trifluorobenzoic acid?

The exact mass of 2,3,4-Trifluorobenzoic acid is 176.00851382 g/mol.

How many topological polar surface areas does 2,3,4-Trifluorobenzoic acid have?

2,3,4-Trifluorobenzoic acid has a topological polar surface area of 37.3Ų.

How many heavy atom counts are present in 2,3,4-Trifluorobenzoic acid?

2,3,4-Trifluorobenzoic acid has 12 heavy atom counts.

Is 2,3,4-Trifluorobenzoic acid considered as a canonicalized compound in PubChem?

Yes, 2,3,4-Trifluorobenzoic acid is considered as a canonicalized compound in PubChem.