What is the molecular formula of 2,3,4,5-Tetrahydro-5-methyl-1H-pyrido[4,3-b]indol-1-one?
The molecular formula is C12H12N2O.
What is the molecular weight of 2,3,4,5-Tetrahydro-5-methyl-1H-pyrido[4,3-b]indol-1-one?
The molecular weight is 200.24 g/mol.
What is the IUPAC name of 2,3,4,5-Tetrahydro-5-methyl-1H-pyrido[4,3-b]indol-1-one?
The IUPAC name is 5-methyl-3,4-dihydro-2H-pyrido[4,3-b]indol-1-one.
What is the Canonical SMILES representation of 2,3,4,5-Tetrahydro-5-methyl-1H-pyrido[4,3-b]indol-1-one?
CN1C2=C(C3=CC=CC=C31)C(=O)NCC2.
What is the InChIKey of 2,3,4,5-Tetrahydro-5-methyl-1H-pyrido[4,3-b]indol-1-one?
The InChIKey is GLHMAFAXJJECMG-UHFFFAOYSA-N.
What is the XLogP3-AA value for 2,3,4,5-Tetrahydro-5-methyl-1H-pyrido[4,3-b]indol-1-one?
The XLogP3-AA value is 1.3.
How many hydrogen bond donor counts are there in 2,3,4,5-Tetrahydro-5-methyl-1H-pyrido[4,3-b]indol-1-one?
There is 1 hydrogen bond donor count.
What is the topological polar surface area of 2,3,4,5-Tetrahydro-5-methyl-1H-pyrido[4,3-b]indol-1-one?
The topological polar surface area is 34 Å2.
Is 2,3,4,5-Tetrahydro-5-methyl-1H-pyrido[4,3-b]indol-1-one a canonicalized compound?
Yes, it is a canonicalized compound.
How many covalently-bonded units are there in 2,3,4,5-Tetrahydro-5-methyl-1H-pyrido[4,3-b]indol-1-one?
There is 1 covalently-bonded unit.