[2-(2-Oxopropoxy)phenoxy]acetic acid

• Catalog Number: ACMA00002165
• Category: Ethers
• Molecular Weight: 224.21
• Molecular Formula: C₁₁H₁₂O₄
• Hazard Statements: H302-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of [2-(2-Oxopropoxy)phenoxy]acetic acid?

The molecular formula of [2-(2-Oxopropoxy)phenoxy]acetic acid is C11H12O5.

What is the PubChem CID of [2-(2-Oxopropoxy)phenoxy]acetic acid?

The PubChem CID of [2-(2-Oxopropoxy)phenoxy]acetic acid is 746016.

What is the IUPAC name of [2-(2-Oxopropoxy)phenoxy]acetic acid?

The IUPAC name of [2-(2-Oxopropoxy)phenoxy]acetic acid is 2-[2-(2-oxopropoxy)phenoxy]acetic acid.

What is the InChI of [2-(2-Oxopropoxy)phenoxy]acetic acid?

The InChI of [2-(2-Oxopropoxy)phenoxy]acetic acid is InChI=1S/C11H12O5/c1-8(12)6-15-9-4-2-3-5-10(9)16-7-11(13)14/h2-5H,6-7H2,1H3,(H,13,14).

What is the InChIKey of [2-(2-Oxopropoxy)phenoxy]acetic acid?

The InChIKey of [2-(2-Oxopropoxy)phenoxy]acetic acid is CVGRNKJSGVQYGB-UHFFFAOYSA-N.

What is the molecular weight of [2-(2-Oxopropoxy)phenoxy]acetic acid?

The molecular weight of [2-(2-Oxopropoxy)phenoxy]acetic acid is 224.21 g/mol.

What is the XLogP3 value of [2-(2-Oxopropoxy)phenoxy]acetic acid?

The XLogP3 value of [2-(2-Oxopropoxy)phenoxy]acetic acid is 0.7.

How many hydrogen bond donor count does [2-(2-Oxopropoxy)phenoxy]acetic acid have?

[2-(2-Oxopropoxy)phenoxy]acetic acid has 1 hydrogen bond donor count.

How many hydrogen bond acceptor count does [2-(2-Oxopropoxy)phenoxy]acetic acid have?

[2-(2-Oxopropoxy)phenoxy]acetic acid has 5 hydrogen bond acceptor count.

How many rotatable bond count does [2-(2-Oxopropoxy)phenoxy]acetic acid have?

[2-(2-Oxopropoxy)phenoxy]acetic acid has 6 rotatable bond count.