2,2-Dimorpholinodiethylether

• CAS: 6425-39-4
• Catalog Number: ACM6425394
• Category: Main Products
• Molecular Weight: 244.33
• Molecular Formula: C12H24N2O3
• Synonyms: 4,4′-(Oxydi-2,1-ethanediyl)bismorpholine
• Boiling Point: 309 °C
• Flash Point: 146 °C (Lit.)
• Density: 1.06
• Appearance: Light yellow clear liquid

Custom Q&A

What is the IUPAC Name of 2,2-Dimorpholinodiethylether?

The IUPAC Name of 2,2-Dimorpholinodiethylether is 4-[2-(2-morpholin-4-ylethoxy)ethyl]morpholine.

What is the molecular formula of 2,2-Dimorpholinodiethylether?

The molecular formula of 2,2-Dimorpholinodiethylether is C12H24N2O3.

What is the molecular weight of 2,2-Dimorpholinodiethylether?

The molecular weight of 2,2-Dimorpholinodiethylether is 244.33 g/mol.

What is the InChI of 2,2-Dimorpholinodiethylether?

The InChI of 2,2-Dimorpholinodiethylether is InChI=1S/C12H24N2O3/c1-7-15-8-2-13(1)5-11-17-12-6-14-3-9-16-10-4-14/h1-12H2.

What is the InChIKey of 2,2-Dimorpholinodiethylether?

The InChIKey of 2,2-Dimorpholinodiethylether is ZMSQJSMSLXVTKN-UHFFFAOYSA-N.

What is the Canonical SMILES of 2,2-Dimorpholinodiethylether?

The Canonical SMILES of 2,2-Dimorpholinodiethylether is C1COCCN1CCOCCN2CCOCC2.

What is the CAS number of 2,2-Dimorpholinodiethylether?

The CAS number of 2,2-Dimorpholinodiethylether is 6425-39-4.

What is the XLogP3-AA value of 2,2-Dimorpholinodiethylether?

The XLogP3-AA value of 2,2-Dimorpholinodiethylether is -0.6.

How many hydrogen bond acceptor count does 2,2-Dimorpholinodiethylether have?

2,2-Dimorpholinodiethylether has 5 hydrogen bond acceptor count.

How many rotatable bond count does 2,2-Dimorpholinodiethylether have?

2,2-Dimorpholinodiethylether has 6 rotatable bond count.