(1S,2S)-2-Methoxycyclohexanol

• Catalog Number: ACMA00003005
• Category: Ethers
• Molecular Weight: 130.18
• Molecular Formula: C₇H₁₀ClNO
• Hazard Statements: H317
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (1S,2S)-2-Methoxycyclohexanol?

The molecular formula is C7H14O2.

What is the molecular weight of (1S,2S)-2-Methoxycyclohexanol?

The molecular weight is 130.18 g/mol.

What is the IUPAC name of (1S,2S)-2-Methoxycyclohexanol?

The IUPAC name is (1S,2S)-2-methoxycyclohexan-1-ol.

What is the InChI of (1S,2S)-2-Methoxycyclohexanol?

The InChI is InChI=1S/C7H14O2/c1-9-7-5-3-2-4-6(7)8/h6-8H,2-5H2,1H3/t6-,7-/m0/s1.

What is the InChIKey of (1S,2S)-2-Methoxycyclohexanol?

The InChIKey is DCQQZLGQRIVCNH-BQBZGAKWSA-N.

What is the canonical SMILES of (1S,2S)-2-Methoxycyclohexanol?

The canonical SMILES is COC1CCCCC1O.

What is the isomeric SMILES of (1S,2S)-2-Methoxycyclohexanol?

The isomeric SMILES is CO[C@H]1CCCC[C@@H]1O.

What is the XLogP3-AA value of (1S,2S)-2-Methoxycyclohexanol?

The XLogP3-AA value is 0.7.

How many hydrogen bond donor counts are there in (1S,2S)-2-Methoxycyclohexanol?

There is 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts are there in (1S,2S)-2-Methoxycyclohexanol?

There are 2 hydrogen bond acceptor counts.