(1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl 2-hydroxypropanoate

• Catalog Number: ACMA00000530
• Category: Alcohols
• Molecular Weight: 228.33
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (-)-menthyl lactate?

The molecular formula of (-)-menthyl lactate is C13H24O3.

What is the molecular weight of (-)-menthyl lactate?

The molecular weight of (-)-menthyl lactate is 228.33 g/mol.

What is the IUPAC name of (-)-menthyl lactate?

The IUPAC name of (-)-menthyl lactate is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-hydroxypropanoate.

What is the Canonical SMILES of (-)-menthyl lactate?

The Canonical SMILES of (-)-menthyl lactate is CC1CCC(C(C1)OC(=O)C(C)O)C(C)C.

How many hydrogen bond donor counts does (-)-menthyl lactate have?

(-)-menthyl lactate has 1 hydrogen bond donor count.

What is the exact mass of (-)-menthyl lactate?

The exact mass of (-)-menthyl lactate is 228.17254462 g/mol.

How many rotatable bond counts does (-)-menthyl lactate have?

(-)-menthyl lactate has 4 rotatable bond counts.

What is the topological polar surface area of (-)-menthyl lactate?

The topological polar surface area of (-)-menthyl lactate is 46.5 Ų.

How many defined atom stereocenter counts does (-)-menthyl lactate have?

(-)-menthyl lactate has 3 defined atom stereocenter counts.

What is the complexity value of (-)-menthyl lactate?

The complexity value of (-)-menthyl lactate is 237.