1H-Inden-1-amine,5-chloro-2,3-dihydro-

• CAS: 67120-39-2
• Catalog Number: ACM67120392
• Category: Other Products
• Molecular Weight: 167.64
• Molecular Formula: C₉H₁₀ClN
• Synonyms: 5-CHLORO-INDAN-1-YLAMINE;1H-INDEN-1-AMINE, 5-CHLORO-2,3-DIHYDRO-;5-Chloro-1-indanylamine;1-AMino-5-chloroindane;5-Chloroindan-1-aMine;5-chloro-2,3-dihydro-1H-inden-1-amine HCl

Custom Q&A

What is the molecular formula of 1H-Inden-1-amine, 5-chloro-2,3-dihydro?

The molecular formula is C9H10ClN.

What is the molecular weight of 1H-Inden-1-amine, 5-chloro-2,3-dihydro?

The molecular weight is 167.63 g/mol.

What is the IUPAC name of 1H-Inden-1-amine, 5-chloro-2,3-dihydro?

The IUPAC name is 5-chloro-2,3-dihydro-1H-inden-1-amine.

What is the InChI of 1H-Inden-1-amine, 5-chloro-2,3-dihydro?

The InChI is InChI=1S/C9H10ClN/c10-7-2-3-8-6(5-7)1-4-9(8)11/h2-3,5,9H,1,4,11H2.

What is the InChIKey of 1H-Inden-1-amine, 5-chloro-2,3-dihydro?

The InChIKey is CCNOGOGUHOMLMI-UHFFFAOYSA-N.

How many hydrogen bond donor counts does 1H-Inden-1-amine, 5-chloro-2,3-dihydro have?

It has 1 hydrogen bond donor count.

What is the XLogP3-AA value of 1H-Inden-1-amine, 5-chloro-2,3-dihydro?

The XLogP3-AA value is 1.8.

What is the topological polar surface area of 1H-Inden-1-amine, 5-chloro-2,3-dihydro?

The topological polar surface area is 26.

Is the compound canonicalized?

Yes, the compound is canonicalized.

What is the Formal Charge of 1H-Inden-1-amine, 5-chloro-2,3-dihydro?

The Formal Charge is 0.