What is the molecular formula of 1H-Benzimidazole-5-carbonitrile,2-chloro-(9ci)?
The molecular formula is C8H4ClN3.
What is the molecular weight of 1H-Benzimidazole-5-carbonitrile,2-chloro-(9ci)?
The molecular weight is 177.59 g/mol.
What is the IUPAC name of 1H-Benzimidazole-5-carbonitrile,2-chloro-(9ci)?
The IUPAC name is 2-chloro-3H-benzimidazole-5-carbonitrile.
What is the InChI of 1H-Benzimidazole-5-carbonitrile,2-chloro-(9ci)?
The InChI is InChI=1S/C8H4ClN3/c9-8-11-6-2-1-5(4-10)3-7(6)12-8/h1-3H,(H,11,12).
What is the InChIKey of 1H-Benzimidazole-5-carbonitrile,2-chloro-(9ci)?
The InChIKey is WDWQXEUJKGYNPZ-UHFFFAOYSA-N.
What is the Canonical SMILES of 1H-Benzimidazole-5-carbonitrile,2-chloro-(9ci)?
The Canonical SMILES is C1=CC2=C(C=C1C#N)NC(=N2)Cl.
What is the XLogP3 value of 1H-Benzimidazole-5-carbonitrile,2-chloro-(9ci)?
The XLogP3 value is 2.4.
How many hydrogen bond donor counts are in 1H-Benzimidazole-5-carbonitrile,2-chloro-(9ci)?
There is 1 hydrogen bond donor count.
What is the topological polar surface area of 1H-Benzimidazole-5-carbonitrile,2-chloro-(9ci)?
The topological polar surface area is 52.5 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.