1H,1H,5H-Octafluoropentyl acrylate

• CAS: 376-84-1
• Catalog Number: ACM376841
• Category: Polymer/Macromolecule
• Molecular Weight: 286.12
• Molecular Formula: C₈H₆F₈O₂
• Synonyms: DAIKIN R-5410;ACRYLIC ACID 1H,1H,5H-OCTAFLUOROPENTYL ESTER;1H,1H,5H-OCTAFLUOROPENTYL ACRYLATE;2,2,3,3,4,4,5,5-OCTAFLUOROPENTYL ACRYLATE;2-Propenoic acid, 2,2,3,3,4,4,5,5-octafluoropentyl ester;acrylicacid2,2,3,3,4,4,5,5-octafluoro-pentylester;Acrylic acid

Custom Q&A

What is the molecular formula of 1H,1H,5H-Octafluoropentyl acrylate?

The molecular formula of 1H,1H,5H-Octafluoropentyl acrylate is C8H6F8O2.

What is the molecular weight of 1H,1H,5H-Octafluoropentyl acrylate?

The molecular weight of 1H,1H,5H-Octafluoropentyl acrylate is 286.12 g/mol.

What is the IUPAC name of 1H,1H,5H-Octafluoropentyl acrylate?

The IUPAC name of 1H,1H,5H-Octafluoropentyl acrylate is 2,2,3,3,4,4,5,5-octafluoropentyl prop-2-enoate.

What is the InChIKey of 1H,1H,5H-Octafluoropentyl acrylate?

The InChIKey of 1H,1H,5H-Octafluoropentyl acrylate is WISUNKZXQSKYMR-UHFFFAOYSA-N.

What is the canonical SMILES of 1H,1H,5H-Octafluoropentyl acrylate?

The canonical SMILES of 1H,1H,5H-Octafluoropentyl acrylate is C=CC(=O)OCC(C(C(C(F)F)(F)F)(F)F)(F)F.

What is the CAS number of 1H,1H,5H-Octafluoropentyl acrylate?

The CAS number of 1H,1H,5H-Octafluoropentyl acrylate is 376-84-1.

What is the XLogP3-AA value of 1H,1H,5H-Octafluoropentyl acrylate?

The XLogP3-AA value of 1H,1H,5H-Octafluoropentyl acrylate is 3.6.

How many hydrogen bond donor counts does 1H,1H,5H-Octafluoropentyl acrylate have?

1H,1H,5H-Octafluoropentyl acrylate has 0 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 1H,1H,5H-Octafluoropentyl acrylate have?

1H,1H,5H-Octafluoropentyl acrylate has 10 hydrogen bond acceptor counts.

How many rotatable bond counts does 1H,1H,5H-Octafluoropentyl acrylate have?

1H,1H,5H-Octafluoropentyl acrylate has 7 rotatable bond counts.