What is the molecular formula of 1H,1H,2H,2H-Perfluorooctyltrichlorosilane?
The molecular formula is C8H4Cl3F13Si.
What is the IUPAC name of 1H,1H,2H,2H-Perfluorooctyltrichlorosilane?
The IUPAC name is trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane
What is the InChIKey of 1H,1H,2H,2H-Perfluorooctyltrichlorosilane?
The InChIKey is PISDRBMXQBSCIP-UHFFFAOYSA-N
What is the Canonical SMILES of 1H,1H,2H,2H-Perfluorooctyltrichlorosilane?
C(C[Si](Cl)(Cl)Cl)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
What is the molecular weight of 1H,1H,2H,2H-Perfluorooctyltrichlorosilane?
The molecular weight is 481.5 g/mol
How many hydrogen bond donor counts are there in 1H,1H,2H,2H-Perfluorooctyltrichlorosilane?
There are 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in 1H,1H,2H,2H-Perfluorooctyltrichlorosilane?
There are 13 hydrogen bond acceptor counts.
What is the exact mass of 1H,1H,2H,2H-Perfluorooctyltrichlorosilane?
The exact mass is 479.894026 g/mol
What is the topological polar surface area of 1H,1H,2H,2H-Perfluorooctyltrichlorosilane?
The topological polar surface area is 0Ų
How many heavy atom counts are there in 1H,1H,2H,2H-Perfluorooctyltrichlorosilane?
There are 25 heavy atom counts.