(1E,3Z)-1-Methoxy-2-methyl-3-(trimethylsilyloxy)-1,3-pentadiene

• CAS: 72486-93-2
• Catalog Number: ACM72486932-1
• Category: Enol Ethers
• Molecular Weight: 200.35
• Hazard Statements: H226-H302 + H312 + H332
• RIDADR: UN 1993C 3 / PGIII
• Symbol: GHS02

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C10H20O2Si.

What is the molecular weight of the compound?

The molecular weight is 200.35 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is [(1E,3Z)-1-methoxy-2-methylpenta-1,3-dien-3-yl]oxy-trimethylsilane.

What is the InChI of the compound?

The InChI is InChI=1S/C10H20O2Si/c1-7-10(9(2)8-11-3)12-13(4,5)6/h7-8H,1-6H3/b9-8+,10-7-.

What is the InChIKey of the compound?

The InChIKey is SSGAQVOLXCOJGN-AZRUORMVSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is CC=C(C(=COC)C)O[Si](C)(C)C.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 2 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 4 rotatable bond counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.