1-Phenyl-1H-pyrazole-4-carbaldehyde

• CAS: 54605-72-0
• Catalog Number: ACM54605720
• Category: Other Products
• Molecular Weight: 172.18
• Molecular Formula: C₁₀H₈N₂O
• Synonyms: TIMTEC-BB SBB010539;1-PHENYL-1H-PYRAZOLE-4-CARBOXALDEHYDE;1-PHENYL-1H-PYRAZOLE-4-CARBALDEHYDE;AKOS BBS-00006876;AKOS PAO-0282;CHEMBRDG-BB 4301500;1-Phenyl-1H-pyrazole-4-carboxaldehyde 98%;1-Phenyl-1H-pyrazole-4-carbaldehyde ,98%
• Melting Point: 85-88
• Hazard Statements: Xi
• Safety Description: 26-37/39
• Supplemental Hazard Statements: H315-H319-H335
• Symbol: GHS07

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is 1-phenylpyrazole-4-carbaldehyde.

What is the molecular formula of the compound?

The molecular formula of the compound is C10H8N2O.

What is the CAS number of the compound?

The CAS number of the compound is 54605-72-0.

What is the molecular weight of the compound?

The molecular weight of the compound is 172.18 g/mol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C10H8N2O/c13-8-9-6-11-12(7-9)10-4-2-1-3-5-10/h1-8H.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 2 hydrogen bond acceptor counts.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 1.4.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 34.9 ?2.

Is the compound canonically represented?

Yes, the compound is canonically represented.