1-p-Methoxyphenylpyrazole-4-carboxaldehyde

• CAS: 99984-70-0
• Catalog Number: ACM99984700
• Category: Other Products
• Molecular Weight: 202.2093
• Molecular Formula: C₁₁H₁₀N₂O₂
• Synonyms: 1-p-methoxyphenylpyrazole-4-carboxaldehyde;1-(4-Methoxyphenyl)-1H-pyrazole-4-carbaldehyde

Custom Q&A

What is the molecular formula of 1-p-Methoxyphenylpyrazole-4-carboxaldehyde?

The molecular formula is C11H10N2O2.

What are some synonyms for 1-p-Methoxyphenylpyrazole-4-carboxaldehyde?

Some synonyms include 1-(4-methoxyphenyl)-1H-pyrazole-4-carbaldehyde and 1-(4-methoxyphenyl)pyrazole-4-carbaldehyde.

When was 1-p-Methoxyphenylpyrazole-4-carboxaldehyde first created?

It was first created on September 13, 2005.

What is the molecular weight of 1-p-Methoxyphenylpyrazole-4-carboxaldehyde?

The molecular weight is 202.21 g/mol.

What is the InChIKey of 1-p-Methoxyphenylpyrazole-4-carboxaldehyde?

The InChIKey is NRVPYMGFCLDQLB-UHFFFAOYSA-N.

What is the Canonical SMILES of 1-p-Methoxyphenylpyrazole-4-carboxaldehyde?

The Canonical SMILES is COC1=CC=C(C=C1)N2C=C(C=N2)C=O.

How many hydrogen bond acceptors are in 1-p-Methoxyphenylpyrazole-4-carboxaldehyde?

There are 3 hydrogen bond acceptors.

What is the exact mass of 1-p-Methoxyphenylpyrazole-4-carboxaldehyde?

The exact mass is 202.074227566 g/mol.

Is 1-p-Methoxyphenylpyrazole-4-carboxaldehyde a canonicalized compound?

Yes, it is a canonicalized compound.

How many rotatable bond counts are in 1-p-Methoxyphenylpyrazole-4-carboxaldehyde?

There are 3 rotatable bond counts.