CAS
--- Purity
---
--- Purity
---
Shopping basket
1-Formyl-2-naphthyl acetate
Catalog Number
ACMA00002383
Category
Ethers
Molecular Weight
214.22
Molecular Formula
C13H8FNO
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of 1-Formyl-2-naphthyl acetate?
The molecular formula of 1-Formyl-2-naphthyl acetate is C13H10O3.
What is the molecular weight of 1-Formyl-2-naphthyl acetate?
The molecular weight of 1-Formyl-2-naphthyl acetate is 214.22 g/mol.
What are some synonyms for 1-Formyl-2-naphthyl acetate?
Some synonyms for 1-Formyl-2-naphthyl acetate include 1-FORMYL-2-NAPHTHYL ACETATE, 67727-65-5, and (1-formylnaphthalen-2-yl) acetate.
What is the IUPAC name of 1-Formyl-2-naphthyl acetate?
The IUPAC name of 1-Formyl-2-naphthyl acetate is (1-formylnaphthalen-2-yl) acetate.
What is the InChIKey of 1-Formyl-2-naphthyl acetate?
The InChIKey of 1-Formyl-2-naphthyl acetate is ZEYRSVAXRVITRM-UHFFFAOYSA-N.
What is the Canonical SMILES of 1-Formyl-2-naphthyl acetate?
The Canonical SMILES of 1-Formyl-2-naphthyl acetate is CC(=O)OC1=C(C2=CC=CC=C2C=C1)C=O.
What is the XLogP3-AA value of 1-Formyl-2-naphthyl acetate?
The XLogP3-AA value of 1-Formyl-2-naphthyl acetate is 2.4.
How many hydrogen bond acceptors are there in 1-Formyl-2-naphthyl acetate?
There are 3 hydrogen bond acceptors in 1-Formyl-2-naphthyl acetate.
What is the topological polar surface area of 1-Formyl-2-naphthyl acetate?
The topological polar surface area of 1-Formyl-2-naphthyl acetate is 43.4Ų.
Is 1-Formyl-2-naphthyl acetate considered a canonical compound?
Yes, 1-Formyl-2-naphthyl acetate is considered a canonical compound.
Recommended Products
