1-Ethynyl-4-methoxy-2-methylbenzene

• CAS: 74331-69-4
• Catalog Number: ACM74331694
• Category: Alkynes
• Molecular Weight: 146.19
• Molecular Formula: C₁₀H₁₁N
• Hazard Statements: H302-H319
• RIDADR: UN 1993BE 3 / PGII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C10H10O.

What is the molecular weight of the compound?

The molecular weight of the compound is 146.19 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 1-ethynyl-4-methoxy-2-methylbenzene.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C10H10O/c1-4-9-5-6-10(11-3)7-8(9)2/h1,5-7H,2-3H3.

What is the InChIKey of the compound?

The InChIKey of the compound is IETBNYUYILAKFK-UHFFFAOYSA-N.

What is the CAS number of the compound?

The CAS number of the compound is 74331-69-4.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 2.5.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many rotatable bond counts does the compound have?

The compound has 2 rotatable bond counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.