1-Chloro-3-fluoro-2-methoxybenzene

• Catalog Number: ACMA00002586
• Category: Ethers
• Molecular Weight: 160.57
• Molecular Formula: C₇H₅F₄NO
• Hazard Statements: H301-H317-H319-H412
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS06

Custom Q&A

What is the molecular formula of 1-Chloro-3-fluoro-2-methoxybenzene?

The molecular formula is C7H6ClFO.

What is the molecular weight of 1-Chloro-3-fluoro-2-methoxybenzene?

The molecular weight is 160.57 g/mol.

What is the IUPAC name of 1-Chloro-3-fluoro-2-methoxybenzene?

The IUPAC name is 1-chloro-3-fluoro-2-methoxybenzene.

What is the InChI of 1-Chloro-3-fluoro-2-methoxybenzene?

The InChI is InChI=1S/C7H6ClFO/c1-10-7-5(8)3-2-4-6(7)9/h2-4H,1H3.

What is the InChIKey of 1-Chloro-3-fluoro-2-methoxybenzene?

The InChIKey is QASFEHCRPLPGES-UHFFFAOYSA-N.

What is the canonical SMILES of 1-Chloro-3-fluoro-2-methoxybenzene?

The canonical SMILES is COC1=C(C=CC=C1Cl)F.

What is the CAS number of 1-Chloro-3-fluoro-2-methoxybenzene?

The CAS number is 53145-38-3.

What is the XLogP3-AA value of 1-Chloro-3-fluoro-2-methoxybenzene?

The XLogP3-AA value is 2.6.

How many hydrogen bond donor counts does 1-Chloro-3-fluoro-2-methoxybenzene have?

1-Chloro-3-fluoro-2-methoxybenzene has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 1-Chloro-3-fluoro-2-methoxybenzene have?

1-Chloro-3-fluoro-2-methoxybenzene has 2 hydrogen bond acceptor counts.