1-[(Ammoniooxy)methyl]-4-methoxybenzene chloride

• Catalog Number: ACMA00002704
• Category: Ethers
• Molecular Weight: 189.64
• Molecular Formula: C₈H₁₁NO₄S
• Hazard Statements: H302-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C8H12ClNO2.

What is the molecular weight of the compound?

The molecular weight is 189.64 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is O-[(4-methoxyphenyl)methyl]hydroxylamine;hydrochloride.

What is the InChI of the compound?

The InChI is InChI=1S/C8H11NO2.ClH/c1-10-8-4-2-7(3-5-8)6-11-9;/h2-5H,6,9H2,1H3;1H.

What is the InChIKey of the compound?

The InChIKey is DHEZQYZJFCIQQA-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is COC1=CC=C(C=C1)CON.Cl.

What is the CAS registry number of the compound?

The CAS registry number is 876-33-5.

What is the ChEMBL ID of the compound?

The ChEMBL ID is CHEMBL3764351.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count is 2.

What is the hydrogen bond acceptor count of the compound?

The hydrogen bond acceptor count is 3.