1-Amino-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide

• Catalog Number: ACMA00002410
• Category: Ethers
• Molecular Weight: 264.32
• Molecular Formula: C₁₄H₁₉NO₃
• Hazard Statements: H301
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C14H20N2O3.

What is the molecular weight of the compound?

The molecular weight is 264.32 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 1-amino-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide.

What is the InChI of the compound?

The InChI is InChI=1S/C14H20N2O3/c1-18-11-6-5-10(9-12(11)19-2)16-13(17)14(15)7-3-4-8-14/h5-6,9H,3-4,7-8,15H2,1-2H3,(H,16,17).

What is the InChIKey of the compound?

The InChIKey is KSWAUNWWIYSNGF-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is COC1=C(C=C(C=C1)NC(=O)C2(CCCC2)N)OC.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is 1.2.

How many hydrogen bond donor counts does the compound have?

The compound has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 4 rotatable bond counts.