1-Amino-8-naphthol-4,6-disulfonic acid

• CAS: 130-23-4
• Catalog Number: ACM130234
• Category: Other Products
• Molecular Weight: 319.31
• Molecular Formula: C₁₀H₉NO₇S₂
• Synonyms: K ACID;EUROPEAN K-ACID;1 AMINO 8 HYDROXY 4:6 DISULFONIC ACID;1-AMINO-8-NAPHTHOL-4,6-DISULFONIC ACID;4-amino-5-hydroxynaphthalene-1,7-disulfonic acid;4-amino-5-hydroxynaphthalene-1,7-disulphonic acid;1-amino-8-naphtho-4,6-Disulfonic acid ;1-Amino-8-Naphthol-4￡6-disulfonic acid/European K Acid

Custom Q&A

What is the molecular formula of 1-Amino-8-naphthol-4,6-disulfonic acid?

The molecular formula of 1-Amino-8-naphthol-4,6-disulfonic acid is C10H9NO7S2.

What is the molecular weight of 1-Amino-8-naphthol-4,6-disulfonic acid?

The molecular weight of 1-Amino-8-naphthol-4,6-disulfonic acid is 319.3 g/mol.

What is the IUPAC name of 1-Amino-8-naphthol-4,6-disulfonic acid?

The IUPAC name of 1-Amino-8-naphthol-4,6-disulfonic acid is 4-amino-5-hydroxynaphthalene-1,7-disulfonic acid.

What is the InChI of 1-Amino-8-naphthol-4,6-disulfonic acid?

The InChI of 1-Amino-8-naphthol-4,6-disulfonic acid is InChI=1S/C10H9NO7S2/c11-7-1-2-9(20(16,17)18)6-3-5(19(13,14)15)4-8(12)10(6)7/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18).

What is the InChIKey of 1-Amino-8-naphthol-4,6-disulfonic acid?

The InChIKey of 1-Amino-8-naphthol-4,6-disulfonic acid is ZUQOBHTUMCEQBG-UHFFFAOYSA-N.

What is the canonical SMILES of 1-Amino-8-naphthol-4,6-disulfonic acid?

The canonical SMILES of 1-Amino-8-naphthol-4,6-disulfonic acid is C1=CC(=C2C=C(C=C(C2=C1N)O)S(=O)(=O)O)S(=O)(=O)O.

What is the CAS number of 1-Amino-8-naphthol-4,6-disulfonic acid?

The CAS number of 1-Amino-8-naphthol-4,6-disulfonic acid is 130-23-4.

What is the hydrogen bond donor count of 1-Amino-8-naphthol-4,6-disulfonic acid?

The hydrogen bond donor count of 1-Amino-8-naphthol-4,6-disulfonic acid is 4.

What is the hydrogen bond acceptor count of 1-Amino-8-naphthol-4,6-disulfonic acid?

The hydrogen bond acceptor count of 1-Amino-8-naphthol-4,6-disulfonic acid is 8.