1-Amino-1-Deoxy-d-fructose

• CAS: 51296-39-0
• Catalog Number: ACM51296390
• Category: Other Products
• Molecular Weight: 179.17
• Molecular Formula: C₆H₁₃NO₅
• Synonyms: 1-AMINO-1-DEOXY-D-FRUCTOSE

Custom Q&A

What is the molecular formula of 1-Amino-1-Deoxy-D-Fructose?

The molecular formula of 1-Amino-1-Deoxy-D-Fructose is C6H13NO5.

What is the molecular weight of 1-Amino-1-Deoxy-D-Fructose?

The molecular weight of 1-Amino-1-Deoxy-D-Fructose is 179.17 g/mol.

What is the IUPAC name of 1-Amino-1-Deoxy-D-Fructose?

The IUPAC name of 1-Amino-1-Deoxy-D-Fructose is (3S,4S,5R)-2-(aminomethyl)-5-(hydroxymethyl)oxolane-2,3,4-triol.

What is the InChI of 1-Amino-1-Deoxy-D-Fructose?

The InChI of 1-Amino-1-Deoxy-D-Fructose is InChI=1S/C6H13NO5/c7-2-6(11)5(10)4(9)3(1-8)12-6/h3-5,8-11H,1-2,7H2/t3-,4-,5+,6?/m1/s1.

How many hydrogen bond donor counts are there in 1-Amino-1-Deoxy-D-Fructose?

There are 5 hydrogen bond donor counts in 1-Amino-1-Deoxy-D-Fructose.

What is the XLogP3-AA value of 1-Amino-1-Deoxy-D-Fructose?

The XLogP3-AA value of 1-Amino-1-Deoxy-D-Fructose is -2.5.

How many hydrogen bond acceptor counts are there in 1-Amino-1-Deoxy-D-Fructose?

There are 6 hydrogen bond acceptor counts in 1-Amino-1-Deoxy-D-Fructose.

What is the topological polar surface area of 1-Amino-1-Deoxy-D-Fructose?

The topological polar surface area of 1-Amino-1-Deoxy-D-Fructose is 116 Ų.

How many defined atom stereocenter counts are there in 1-Amino-1-Deoxy-D-Fructose?

There are 3 defined atom stereocenter counts in 1-Amino-1-Deoxy-D-Fructose.

Is 1-Amino-1-Deoxy-D-Fructose a canonicalized compound?

Yes, 1-Amino-1-Deoxy-D-Fructose is a canonicalized compound.