1-Acetyl-5-bromoindolin-3-one

• CAS: 106698-07-1
• Catalog Number: ACM106698071
• Category: Bromine Series
• Molecular Weight: 254.08
• Molecular Formula: C₁₀H₈NO₂Br

Custom Q&A

What is the molecular formula of 1-Acetyl-5-bromoindolin-3-one?

The molecular formula of 1-Acetyl-5-bromoindolin-3-one is C10H8BrNO2.

What is the molecular weight of 1-Acetyl-5-bromoindolin-3-one?

The molecular weight of 1-Acetyl-5-bromoindolin-3-one is 254.08 g/mol.

What is the IUPAC name of 1-Acetyl-5-bromoindolin-3-one?

The IUPAC name of 1-Acetyl-5-bromoindolin-3-one is 1-acetyl-5-bromo-2H-indol-3-one.

What is the InChI of 1-Acetyl-5-bromoindolin-3-one?

The InChI of 1-Acetyl-5-bromoindolin-3-one is InChI=1S/C10H8BrNO2/c1-6(13)12-5-10(14)8-4-7(11)2-3-9(8)12/h2-4H,5H2,1H3.

What is the InChIKey of 1-Acetyl-5-bromoindolin-3-one?

The InChIKey of 1-Acetyl-5-bromoindolin-3-one is KXJGSNRAQWDDJT-UHFFFAOYSA-N.

What is the canonical SMILES of 1-Acetyl-5-bromoindolin-3-one?

The canonical SMILES of 1-Acetyl-5-bromoindolin-3-one is CC(=O)N1CC(=O)C2=C1C=CC(=C2)Br.

What is the CAS number of 1-Acetyl-5-bromoindolin-3-one?

The CAS number of 1-Acetyl-5-bromoindolin-3-one is 106698-07-1.

What is the XLogP3-AA value of 1-Acetyl-5-bromoindolin-3-one?

The XLogP3-AA value of 1-Acetyl-5-bromoindolin-3-one is 1.6.

Is 1-Acetyl-5-bromoindolin-3-one a canonicalized compound?

Yes, 1-Acetyl-5-bromoindolin-3-one is a canonicalized compound.