1,8-Bis(phenylthio)-9,10-anthracenedione

• CAS: 13676-91-0
• Catalog Number: ACM13676910
• Category: Solvent Dyes
• Molecular Weight: 424.54
• Molecular Formula: C₂₆H₁₆O₂S₂
• Synonyms: SOLVENT YELLOW 163;1,8-bis(phenylthio)-9,10-anthracenedione;1,8-Bis(phenylthio)anthraquinone;AMAPLAST YELLOW GHS;1,8-bis(phenylthio)anthracene-9,10-dione;9,10-Anthracenedione, 1,8-bis(phenylthio)-;Yellow GHS;C.I.58840
• Density: 1.4 g/cm³

Custom Q&A

What is the molecular formula of 1,8-Bis(phenylthio)-9,10-anthracenedione?

The molecular formula is C26H16O2S2.

What is the molecular weight of 1,8-Bis(phenylthio)-9,10-anthracenedione?

The molecular weight is 424.5 g/mol.

What is the IUPAC name of 1,8-Bis(phenylthio)-9,10-anthracenedione?

The IUPAC name is 1,8-bis(phenylsulfanyl)anthracene-9,10-dione.

What is the InChI of 1,8-Bis(phenylthio)-9,10-anthracenedione?

The InChI is InChI=1S/C26H16O2S2/c27-25-19-13-7-15-21(29-17-9-3-1-4-10-17)23(19)26(28)24-20(25)14-8-16-22(24)30-18-11-5-2-6-12-18/h1-16H.

What is the InChIKey of 1,8-Bis(phenylthio)-9,10-anthracenedione?

The InChIKey is CNRPDCKHCGUKDK-UHFFFAOYSA-N.

What is the canonical SMILES of 1,8-Bis(phenylthio)-9,10-anthracenedione?

The canonical SMILES is C1=CC=C(C=C1)SC2=CC=CC3=C2C(=O)C4=C(C3=O)C=CC=C4SC5=CC=CC=C5.

What is the CAS number of 1,8-Bis(phenylthio)-9,10-anthracenedione?

The CAS number is 13676-91-0.

What is the XLogP3-AA value of 1,8-Bis(phenylthio)-9,10-anthracenedione?

The XLogP3-AA value is 7.

How many hydrogen bond donor counts are there in 1,8-Bis(phenylthio)-9,10-anthracenedione?

There are 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts are there in 1,8-Bis(phenylthio)-9,10-anthracenedione?

There are 4 hydrogen bond acceptor counts.