1-(5-Bromo-2-fluorophenyl)ethanol

• CAS: 552331-15-4
• Catalog Number: ACM552331154
• Category: Bromine Series
• Molecular Formula: C8H8 Br F O

Custom Q&A

What is the molecular formula of 1-(5-Bromo-2-fluorophenyl)ethanol?

The molecular formula of 1-(5-Bromo-2-fluorophenyl)ethanol is C8H8BrFO.

What is the molecular weight of 1-(5-Bromo-2-fluorophenyl)ethanol?

The molecular weight of 1-(5-Bromo-2-fluorophenyl)ethanol is 219.05 g/mol.

What is the IUPAC name of 1-(5-Bromo-2-fluorophenyl)ethanol?

The IUPAC name of 1-(5-Bromo-2-fluorophenyl)ethanol is 1-(5-bromo-2-fluorophenyl)ethanol.

What is the InChI of 1-(5-Bromo-2-fluorophenyl)ethanol?

The InChI of 1-(5-Bromo-2-fluorophenyl)ethanol is InChI=1S/C8H8BrFO/c1-5(11)7-4-6(9)2-3-8(7)10/h2-5,11H,1H3.

What is the InChIKey of 1-(5-Bromo-2-fluorophenyl)ethanol?

The InChIKey of 1-(5-Bromo-2-fluorophenyl)ethanol is QWIJUQVYIYCHMK-UHFFFAOYSA-N.

What is the canonical SMILES of 1-(5-Bromo-2-fluorophenyl)ethanol?

The canonical SMILES of 1-(5-Bromo-2-fluorophenyl)ethanol is CC(C1=C(C=CC(=C1)Br)F)O.

What is the CAS number of 1-(5-Bromo-2-fluorophenyl)ethanol?

The CAS number of 1-(5-Bromo-2-fluorophenyl)ethanol is 552331-15-4.

How many hydrogen bond donor counts does 1-(5-Bromo-2-fluorophenyl)ethanol have?

1-(5-Bromo-2-fluorophenyl)ethanol has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 1-(5-Bromo-2-fluorophenyl)ethanol have?

1-(5-Bromo-2-fluorophenyl)ethanol has 2 hydrogen bond acceptor counts.