What is the molecular formula of 1-(4-Methylphenyl)cyclopentanecarboxylic acid?
The molecular formula is C13H16O2.
What is the synonym for 1-(4-Methylphenyl)cyclopentanecarboxylic acid?
The synonym is 1-(p-Tolyl)cyclopentanecarboxylic acid.
What is the IUPAC name of 1-(4-Methylphenyl)cyclopentanecarboxylic acid?
The IUPAC name is 1-(4-methylphenyl)cyclopentane-1-carboxylic acid.
What is the InChI code for 1-(4-Methylphenyl)cyclopentanecarboxylic acid?
The InChI code is InChI=1S/C13H16O2/c1-10-4-6-11(7-5-10)13(12(14)15)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3,(H,14,15).
What is the InChIKey for 1-(4-Methylphenyl)cyclopentanecarboxylic acid?
The InChIKey is YKDWTRWSHHGVII-UHFFFAOYSA-N.
What is the canonical SMILES notation for 1-(4-Methylphenyl)cyclopentanecarboxylic acid?
The canonical SMILES notation is CC1=CC=C(C=C1)C2(CCCC2)C(=O)O.
What is the CAS number for 1-(4-Methylphenyl)cyclopentanecarboxylic acid?
The CAS number is 80789-75-9.
What is the European Community (EC) number for 1-(4-Methylphenyl)cyclopentanecarboxylic acid?
The European Community (EC) number is 279-556-3.
What is the molecular weight of 1-(4-Methylphenyl)cyclopentanecarboxylic acid?
The molecular weight is 204.26 g/mol.
What is the hydrogen bond donor count of 1-(4-Methylphenyl)cyclopentanecarboxylic acid?
The hydrogen bond donor count is 1.