1,4-Bis(trimethylsilyl)butadiyne,stable crystalline form of butadiyne

• CAS: 4526-07-2
• Catalog Number: ACM4526072
• Category: Alkynes
• Molecular Weight: 194.42
• Molecular Formula: C₁₀H₁₈Si₂
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 1,4-Bis(trimethylsilyl)butadiyne?

The molecular formula of 1,4-Bis(trimethylsilyl)butadiyne is C10H18Si2.

What is the IUPAC name of 1,4-Bis(trimethylsilyl)butadiyne?

The IUPAC name of 1,4-Bis(trimethylsilyl)butadiyne is trimethyl(4-trimethylsilylbuta-1,3-diynyl)silane.

What is the InChI of 1,4-Bis(trimethylsilyl)butadiyne?

The InChI of 1,4-Bis(trimethylsilyl)butadiyne is InChI=1S/C10H18Si2/c1-11(2,3)9-7-8-10-12(4,5)6/h1-6H3.

What is the InChIKey of 1,4-Bis(trimethylsilyl)butadiyne?

The InChIKey of 1,4-Bis(trimethylsilyl)butadiyne is LBNVCJHJRYJVPK-UHFFFAOYSA-N.

What is the canonical SMILES of 1,4-Bis(trimethylsilyl)butadiyne?

The canonical SMILES of 1,4-Bis(trimethylsilyl)butadiyne is C[Si](C)(C)C#CC#C[Si](C)(C)C.

What is the CAS number of 1,4-Bis(trimethylsilyl)butadiyne?

The CAS number of 1,4-Bis(trimethylsilyl)butadiyne is 4526-07-2.

What is the molecular weight of 1,4-Bis(trimethylsilyl)butadiyne?

The molecular weight of 1,4-Bis(trimethylsilyl)butadiyne is 194.42 g/mol.

What is the hydrogen bond donor count of 1,4-Bis(trimethylsilyl)butadiyne?

The hydrogen bond donor count of 1,4-Bis(trimethylsilyl)butadiyne is 0.

What is the hydrogen bond acceptor count of 1,4-Bis(trimethylsilyl)butadiyne?

The hydrogen bond acceptor count of 1,4-Bis(trimethylsilyl)butadiyne is 0.

Is 1,4-Bis(trimethylsilyl)butadiyne a canonicalized compound?

Yes, 1,4-Bis(trimethylsilyl)butadiyne is a canonicalized compound.