--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 1,3-Dimethoxy-2-(methylthio)benzene is C9H12O2S.
The molecular weight of 1,3-Dimethoxy-2-(methylthio)benzene is 184.26 g/mol.
The IUPAC name of 1,3-Dimethoxy-2-(methylthio)benzene is 1,3-dimethoxy-2-methylsulfanylbenzene.
The InChI of 1,3-Dimethoxy-2-(methylthio)benzene is InChI=1S/C9H12O2S/c1-10-7-5-4-6-8(11-2)9(7)12-3/h4-6H,1-3H3.
The InChIKey of 1,3-Dimethoxy-2-(methylthio)benzene is UASQOZQFGVJMFY-UHFFFAOYSA-N.
The canonical SMILES of 1,3-Dimethoxy-2-(methylthio)benzene is COC1=C(C(=CC=C1)OC)SC.
The CAS number of 1,3-Dimethoxy-2-(methylthio)benzene is 33617-67-3.
The XLogP3 value of 1,3-Dimethoxy-2-(methylthio)benzene is 2.
1,3-Dimethoxy-2-(methylthio)benzene has 0 hydrogen bond donor counts.
1,3-Dimethoxy-2-(methylthio)benzene has 3 hydrogen bond acceptor counts.