1-(3-Bromophenyl)propan-1-one

• CAS: 19829-31-3
• Catalog Number: ACM19829313
• Category: Bromine Series
• Molecular Weight: 213.07
• Molecular Formula: C9H9BrO

Custom Q&A

What is the molecular formula of 1-(3-Bromophenyl)propan-1-one?

The molecular formula is C9H9BrO.

What is the molecular weight of 1-(3-Bromophenyl)propan-1-one?

The molecular weight is 213.07 g/mol.

What is the IUPAC name of 1-(3-Bromophenyl)propan-1-one?

The IUPAC name is 1-(3-bromophenyl)propan-1-one.

What is the InChI of 1-(3-Bromophenyl)propan-1-one?

The InChI is InChI=1S/C9H9BrO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3.

What is the InChIKey of 1-(3-Bromophenyl)propan-1-one?

The InChIKey is QSHLXVTVXQTHBS-UHFFFAOYSA-N.

How many hydrogen bond donor counts does 1-(3-Bromophenyl)propan-1-one have?

It has 0 hydrogen bond donor counts.

What is the exact mass of 1-(3-Bromophenyl)propan-1-one?

The exact mass is 211.98368 g/mol.

How many rotatable bond counts does 1-(3-Bromophenyl)propan-1-one have?

It has 2 rotatable bond counts.

What is the topological polar surface area of 1-(3-Bromophenyl)propan-1-one?

The topological polar surface area is 17.1Ų.

Is 1-(3-Bromophenyl)propan-1-one a canonicalized compound?

Yes, it is a canonicalized compound.