1,3-Bis(dimethylamino)-2-propanol

• CAS: 5966-51-8
• Catalog Number: ACM5966518
• Category: Amino Alcohols
• Molecular Weight: 146.23
• Molecular Formula: C₇H₁₈N₂O
• Hazard Statements: H302-H317-H318
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 1,3-Bis(dimethylamino)-2-propanol?

The molecular formula is C7H18N2O.

What is the molecular weight of 1,3-Bis(dimethylamino)-2-propanol?

The molecular weight is 146.23 g/mol.

How is the IUPAC name of 1,3-Bis(dimethylamino)-2-propanol computed?

The IUPAC name is computed as 1,3-bis(dimethylamino)propan-2-ol.

What is the InChI of 1,3-Bis(dimethylamino)-2-propanol?

The InChI is InChI=1S/C7H18N2O/c1-8(2)5-7(10)6-9(3)4/h7,10H,5-6H2,1-4H3.

What is the InChIKey of 1,3-Bis(dimethylamino)-2-propanol?

The InChIKey is JGVZJRHAZOBPMW-UHFFFAOYSA-N.

What is the canonical SMILES of 1,3-Bis(dimethylamino)-2-propanol?

The canonical SMILES is CN(C)CC(CN(C)C)O.

What is the CAS number of 1,3-Bis(dimethylamino)-2-propanol?

The CAS number is 5966-51-8.

What is the European Community (EC) Number of 1,3-Bis(dimethylamino)-2-propanol?

The EC Number is 227-754-5.

What is the DSSTox Substance ID of 1,3-Bis(dimethylamino)-2-propanol?

The DSSTox Substance ID is DTXSID7064071.

Is 1,3-Bis(dimethylamino)-2-propanol a canonicalized compound?

Yes, 1,3-Bis(dimethylamino)-2-propanol is canonicalized.