(1,3-Benzodioxol-5-yloxy)acetic acid

• Catalog Number: ACMA00002937
• Category: Ethers
• Molecular Weight: 196.16
• Molecular Formula: C₉H₈FNO
• Hazard Statements: H302 + H312 + H332
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (1,3-Benzodioxol-5-yloxy)acetic acid?

The molecular formula is C9H8O5.

What are some synonyms for (1,3-Benzodioxol-5-yloxy)acetic acid?

Some synonyms include 2-(1,3-benzodioxol-5-yloxy)acetic acid, (Benzo[1,3]dioxol-5-yloxy)-acetic acid, and 2-(Benzo[d][1,3]dioxol-5-yloxy)acetic acid.

What is the computed IUPAC name of (1,3-Benzodioxol-5-yloxy)acetic acid?

The computed IUPAC name is 2-(1,3-benzodioxol-5-yloxy)acetic acid.

What is the InChI of (1,3-Benzodioxol-5-yloxy)acetic acid?

The InChI is InChI=1S/C9H8O5/c10-9(11)4-12-6-1-2-7-8(3-6)14-5-13-7/h1-3H,4-5H2,(H,10,11).

What is the InChIKey of (1,3-Benzodioxol-5-yloxy)acetic acid?

The InChIKey is OHPMDIAHFMBXQX-UHFFFAOYSA-N.

What is the canonical SMILES of (1,3-Benzodioxol-5-yloxy)acetic acid?

The canonical SMILES is C1OC2=C(O1)C=C(C=C2)OCC(=O)O.

What is the molecular weight of (1,3-Benzodioxol-5-yloxy)acetic acid?

The molecular weight is 196.16 g/mol.

What is the XLogP3 value of (1,3-Benzodioxol-5-yloxy)acetic acid?

The XLogP3 value is 1.2.

What is the hydrogen bond donor count of (1,3-Benzodioxol-5-yloxy)acetic acid?

The hydrogen bond donor count is 1.

What is the hydrogen bond acceptor count of (1,3-Benzodioxol-5-yloxy)acetic acid?

The hydrogen bond acceptor count is 5.