What is the molecular formula of 1,2-Dibromo-4-methoxy-3,5,6-trimethylbenzene?
The molecular formula is C10H12Br2O.
What is the synonyms for 1,2-Dibromo-4-methoxy-3,5,6-trimethylbenzene?
The synonyms are 1,2-Dibromo-4-methoxy-3,5,6-trimethylbenzene, 1359986-20-1, MFCD22370201, 3,4-Dibromo-2,5,6-trimethylanisole, AKOS024262382.
What is the molecular weight of 1,2-Dibromo-4-methoxy-3,5,6-trimethylbenzene?
The molecular weight is 308.01 g/mol.
What is the IUPAC name of 1,2-Dibromo-4-methoxy-3,5,6-trimethylbenzene?
The IUPAC name is 1,2-dibromo-4-methoxy-3,5,6-trimethylbenzene.
What is the InChI of 1,2-Dibromo-4-methoxy-3,5,6-trimethylbenzene?
The InChI is InChI=1S/C10H12Br2O/c1-5-6(2)10(13-4)7(3)9(12)8(5)11/h1-4H3.
What is the InChIKey of 1,2-Dibromo-4-methoxy-3,5,6-trimethylbenzene?
The InChIKey is OILLOHHJHKICLD-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2-Dibromo-4-methoxy-3,5,6-trimethylbenzene?
The canonical SMILES is CC1=C(C(=C(C(=C1OC)C)Br)Br)C.
What is the XLogP3-AA property value of 1,2-Dibromo-4-methoxy-3,5,6-trimethylbenzene?
The XLogP3-AA property value is 4.4.
How many hydrogen bond donor counts does 1,2-Dibromo-4-methoxy-3,5,6-trimethylbenzene have?
It has 0 hydrogen bond donor count.
How many rotatable bond counts does 1,2-Dibromo-4-methoxy-3,5,6-trimethylbenzene have?
It has 1 rotatable bond count.