1-[2-Amino-1-(2-methoxy-phenyl)-ethyl]-pyrrolidine-3-carboxylic acid

• CAS: 886363-84-4
• Catalog Number: ACM886363844
• Category: Other Products
• Molecular Weight: 0
• Molecular Formula: C₁₄H₂₀N₂O₃
• Synonyms: 3-Pyrrolidinecarboxylic acid, 1-[2-amino-1-(2-methoxyphenyl)ethyl]-

Custom Q&A

What is the molecular formula of the compound with PubChem CID 44890915?

The molecular formula is C14H20N2O3.

What is the molecular weight of the compound?

The molecular weight is 264.32 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 1-[2-amino-1-(2-methoxyphenyl)ethyl]pyrrolidine-3-carboxylic acid.

What is the InChIKey of the compound?

The InChIKey is DMSZWLDMGGTLDP-UHFFFAOYSA-N.

What is the canonical SMILES representation of the compound?

The canonical SMILES representation is COC1=CC=CC=C1C(CN)N2CCC(C2)C(=O)O.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is -1.8.

How many hydrogen bond donor counts does the compound have?

The compound has 2 hydrogen bond donor counts.

What is the topological polar surface area of the compound?

The topological polar surface area is 75.8 Å2.

How many defined atom stereocenter counts does the compound have?

The compound has 0 defined atom stereocenter counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.