CAS
13331-52-7 Purity
96%
13331-52-7 Purity
96%
Inquiry Basket
Trioctyltin chloride
CAS
2587-76-0
Catalog Number
ACM2587760
Category
Organic Tin
Molecular Weight
493.82
Molecular Formula
C24H51ClSn
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
chlorotrioctyl-stannan;chlorotrioctyl-ti;chlorotrioctyltin;trioctyltinchloride(6ci);chlorotrioctylstannane;TRI-N-OCTYLTIN CHLORIDE;TRI-N-OCTYLCHLOROTIN;TRIOCTYLTIN CHLORIDE
What is the molecular formula of Trioctyltin chloride?
The molecular formula of Trioctyltin chloride is C24H51ClSn.
What is the molecular weight of Trioctyltin chloride?
The molecular weight of Trioctyltin chloride is 493.8 g/mol.
What is the IUPAC name of Trioctyltin chloride?
The IUPAC name of Trioctyltin chloride is chloro(trioctyl)stannane.
What is the InChI key of Trioctyltin chloride?
The InChI key of Trioctyltin chloride is MCNGJXAXOJDJKO-UHFFFAOYSA-M.
What is the canonical SMILES of Trioctyltin chloride?
The canonical SMILES of Trioctyltin chloride is CCCCCCCC[Sn](CCCCCCCC)(CCCCCCCC)Cl.
What is the CAS number of Trioctyltin chloride?
The CAS number of Trioctyltin chloride is 2587-76-0.
What is the EC number of Trioctyltin chloride?
The EC number of Trioctyltin chloride is 219-969-8.
What is the UNII of Trioctyltin chloride?
The UNII of Trioctyltin chloride is 176VII0B0K.
What is the DSSTox Substance ID of Trioctyltin chloride?
The DSSTox Substance ID of Trioctyltin chloride is DTXSID3029657.
What is the hydrobgen bond donor count of Trioctyltin chloride?
The hydrogen bond donor count of Trioctyltin chloride is 0.
Recommended Products
