CAS
68928-76-7 Purity
---
68928-76-7 Purity
---
Inquiry Basket
Tribenzyltin chloride
CAS
3151-41-5
Catalog Number
ACM3151415
Category
Organic Tin
Molecular Weight
427.55
Molecular Formula
C21H21ClSn
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
TRIBENZYLTIN CHLORIDE;TRIBENZYLCHLOROTIN;chloridtribenzylcinicity;chlorotribenzyl-stannan;chlorotribenzylstannane;Chlorotribenzyltin;Stannane,chlorotribenzyl-;Stannane,chlorotris(phenylmethyl)-
What is the molecular formula of Tribenzyltin chloride?
The molecular formula of Tribenzyltin chloride is C21H21ClSn.
When was Tribenzyltin chloride first created?
Tribenzyltin chloride was first created in 2005-03-26.
What is the molecular weight of Tribenzyltin chloride?
The molecular weight of Tribenzyltin chloride is 427.6 g/mol.
What is the IUPAC Name of Tribenzyltin chloride?
The IUPAC Name of Tribenzyltin chloride is tribenzyl(chloro)stannane.
What is the Canonical SMILES of Tribenzyltin chloride?
The Canonical SMILES of Tribenzyltin chloride is C1=CC=C(C=C1)C[Sn](CC2=CC=CC=C2)(CC3=CC=CC=C3)Cl.
What is the CAS number of Tribenzyltin chloride?
The CAS number of Tribenzyltin chloride is 3151-41-5.
How many rotatable bond counts does Tribenzyltin chloride have?
Tribenzyltin chloride has 6 rotatable bond counts.
What is the exact mass of Tribenzyltin chloride?
The exact mass of Tribenzyltin chloride is 428.035381 g/mol.
Does Tribenzyltin chloride have any hydrogen bond donor count?
No, Tribenzyltin chloride does not have any hydrogen bond donor count.
Is Tribenzyltin chloride a canonicalized compound?
Yes, Tribenzyltin chloride is a canonicalized compound.
Recommended Products
