What is the molecular formula of Sodium bis(2-hydroxyethyl)5-sulphonatoisophthalate?
The molecular formula is C12H13NaO9S.
What is the molecular weight of Sodium bis(2-hydroxyethyl)5-sulphonatoisophthalate?
The molecular weight is 356.28 g/mol.
What are some synonyms for Sodium bis(2-hydroxyethyl)5-sulphonatoisophthalate?
Some synonyms include UO915ZWT2N and Monosodium 1,3-bis(2-hydroxyethyl) 5-sulfoisophthalate.
What is the IUPAC name of Sodium bis(2-hydroxyethyl)5-sulphonatoisophthalate?
The IUPAC name is sodium;3,5-bis(2-hydroxyethoxycarbonyl)benzenesulfonate.
What is the Canonical SMILES representation of Sodium bis(2-hydroxyethyl)5-sulphonatoisophthalate?
The Canonical SMILES representation is C1=C(C=C(C=C1C(=O)OCCO)S(=O)(=O)[O-])C(=O)OCCO.[Na+]
What is the InChIKey of Sodium bis(2-hydroxyethyl)5-sulphonatoisophthalate?
The InChIKey is YZLGIRGCZODDCE-UHFFFAOYSA-M.
What is the Hydrogen Bond Donor Count of Sodium bis(2-hydroxyethyl)5-sulphonatoisophthalate?
The Hydrogen Bond Donor Count is 2.
What is the Hydrogen Bond Acceptor Count of Sodium bis(2-hydroxyethyl)5-sulphonatoisophthalate?
The Hydrogen Bond Acceptor Count is 9.
What is the Rotatable Bond Count of Sodium bis(2-hydroxyethyl)5-sulphonatoisophthalate?
The Rotatable Bond Count is 9.
What is the Topological Polar Surface Area of Sodium bis(2-hydroxyethyl)5-sulphonatoisophthalate?
The Topological Polar Surface Area is 159.2.