CAS
367-67-9 Purity
---
367-67-9 Purity
---
Inquiry Basket
Sodium 5-bromo-2-hydroxybenzoate
CAS
37717-99-0
Catalog Number
ACM37717990
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of Sodium 5-bromo-2-hydroxybenzoate?
The molecular formula is C7H4BrNaO3.
What is the molecular weight of Sodium 5-bromo-2-hydroxybenzoate?
The molecular weight is 239.00 g/mol.
What is the IUPAC name of Sodium 5-bromo-2-hydroxybenzoate?
The IUPAC name is sodium;5-bromo-2-hydroxybenzoate.
What is the InChI of Sodium 5-bromo-2-hydroxybenzoate?
The InChI is InChI=1S/C7H5BrO3.Na/c8-4-1-2-6(9)5(3-4)7(10)11;/h1-3,9H,(H,10,11);/q;+1/p-1.
What is the InChIKey of Sodium 5-bromo-2-hydroxybenzoate?
The InChIKey is XDWBXMATAPGYAK-UHFFFAOYSA-M.
What is the canonical SMILES of Sodium 5-bromo-2-hydroxybenzoate?
The canonical SMILES is C1=CC(=C(C=C1Br)C(=O)[O-])O.[Na+].
What is the CAS number of Sodium 5-bromo-2-hydroxybenzoate?
The CAS number is 37717-99-0.
What is the hydrogen bond donor count of Sodium 5-bromo-2-hydroxybenzoate?
The hydrogen bond donor count is 1.
What is the hydrogen bond acceptor count of Sodium 5-bromo-2-hydroxybenzoate?
The hydrogen bond acceptor count is 3.
Is Sodium 5-bromo-2-hydroxybenzoate a canonical compound?
Yes, Sodium 5-bromo-2-hydroxybenzoate is a canonical compound.
Recommended Products
![3-Bromo-1H-pyrrolo[2,3-b]pyridine](https://resource.alfa-chemistry.com/structure/74420-15-8.gif)
