Sodium 2-amino-4-sulfobenzenesulfonate

• Catalog Number: ACMA00001406
• Category: Amines
• Molecular Weight: 275.23
• Hazard Statements: H302-H410
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of sodium 2-amino-4-sulfobenzenesulfonate?

The molecular formula is C6H6NNaO6S2.

What is the molecular weight of sodium 2-amino-4-sulfobenzenesulfonate?

The molecular weight is 275.2 g/mol.

What is the IUPAC name of sodium 2-amino-4-sulfobenzenesulfonate?

The IUPAC name is sodium;2-amino-4-sulfobenzenesulfonate.

What is the InChI of sodium 2-amino-4-sulfobenzenesulfonate?

The InChI is InChI=1S/C6H7NO6S2.Na/c7-5-3-4(14(8,9)10)1-2-6(5)15(11,12)13;/h1-3H,7H2,(H,8,9,10)(H,11,12,13);/q;+1/p-1.

What is the Canonical SMILES of sodium 2-amino-4-sulfobenzenesulfonate?

The Canonical SMILES is C1=CC(=C(C=C1S(=O)(=O)O)N)S(=O)(=O)[O-].[Na+].

What is the CAS number of sodium 2-amino-4-sulfobenzenesulfonate?

The CAS number is 24605-36-5.

What is the European Community (EC) number of sodium 2-amino-4-sulfobenzenesulfonate?

The EC number is 246-349-4.

What is the hydrogen bond donor count of sodium 2-amino-4-sulfobenzenesulfonate?

The hydrogen bond donor count is 2.

What is the hydrogen bond acceptor count of sodium 2-amino-4-sulfobenzenesulfonate?

The hydrogen bond acceptor count is 7.

Is sodium 2-amino-4-sulfobenzenesulfonate a canonicalized compound?

Yes, it is a canonicalized compound.