Serpentine hydrogen tartrate

• CAS: 18786-24-8
• Catalog Number: ACM18786248
• Category: Other Products
• Molecular Weight: 498.48
• Molecular Formula: C₂₅H₂₆N₂O₉
• Synonyms: SERPENTINE HYDROGEN TARTRATE;serpentine (alkaloid) ;3,4,5,6,16,17-Hexadehydro-16-(methoxycarbonyl)-19α-methyl-18-oxayohimban-4-ium-1-ide;(19 alpha)-3,4,5,6,16,17-Hexadehydro-16-(methoxycarbonyl)-19-methyloxayohimbanium;131-07-7 (Hydroxide inner salt);3,4,5,6,16,17-Hexadehydro-16-(methoxycarbonyl)-19alpha-methyl-18-oxayohimbanium (inneres salz);3,4,5,6-Tetradehydroajmalicine;58782-36-8 (Hydrogen tartrate[1:1] salt)

Custom Q&A

What is the molecular formula of serpentine hydrogen tartrate?

The molecular formula of serpentine hydrogen tartrate is C25H26N2O9.

What are some synonyms for serpentine hydrogen tartrate?

Some synonyms for serpentine hydrogen tartrate are 58782-36-8 and 3,4,5,6,16,17-hexadehydro-16-(methoxycarbonyl)-19alpha-methyloxayohimbanium, salt with [R-(R*,R*)]-tartaric acid.

What is the molecular weight of serpentine hydrogen tartrate?

The molecular weight of serpentine hydrogen tartrate is 498.5 g/mol.

What is the IUPAC name of serpentine hydrogen tartrate?

The IUPAC name of serpentine hydrogen tartrate is methyl (15R,16S,20S)-16-methyl-17-oxa-3-aza-13-azoniapentacyclo[11.8.0.0 2,10 .0 4,9 .0 15,20 ]henicosa-1(13),2(10),4,6,8,11,18-heptaene-19-carboxylate;(2R,3R)-2,3,4-trihydroxy-4-oxobutanoate.

What is the InChIKey of serpentine hydrogen tartrate?

The InChIKey of serpentine hydrogen tartrate is DSBKFQYHOCFEJB-VKSHHDBOSA-N.

What is the canonical SMILES representation of serpentine hydrogen tartrate?

The canonical SMILES representation of serpentine hydrogen tartrate is CC1C2C[N+]3=C(CC2C(=CO1)C(=O)OC)C4=C(C=C3)C5=CC=CC=C5N4.C(C(C(=O)[O-])O)(C(=O)O)O.

What is the CAS number for serpentine hydrogen tartrate?

The CAS number for serpentine hydrogen tartrate is 58782-36-8.

How many hydrogen bond donor counts are there in serpentine hydrogen tartrate?

There are 4 hydrogen bond donor counts in serpentine hydrogen tartrate.

What is the topological polar surface area of serpentine hydrogen tartrate?

The topological polar surface area of serpentine hydrogen tartrate is 173 Ų.

How many defined atom stereocenter counts are there in serpentine hydrogen tartrate?

There are 5 defined atom stereocenter counts in serpentine hydrogen tartrate.