32993-05-8 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is acetic acid;[4-(5-diphenylphosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]-diphenylphosphane;ruthenium.
The molecular weight of the compound is 831.7 g/mol.
The InChI of the compound is InChI=1S/C38H28O4P2.2C2H4O2.Ru/c1-5-13-27(14-6-1)43(28-15-7-2-8-16-28)33-23-21-31-37(41-25-39-31)35(33)36-34(24-22-32-38(36)42-26-40-32)44(29-17-9-3-10-18-29)30-19-11-4-12-20-30;2*1H3,(H,3,4);
The canonical SMILES of the compound is CC(=O)O.CC(=O)O.C1OC2=C(O1)C(=C(C=C2)P(C3=CC=CC=C3)C4=CC=CC=C4)C5=C(C=CC6=C5OCO6)P(C7=CC=CC=C7)C8=CC=CC=C8.[Ru].
The hydrogen bond donor count of the compound is 2.
The hydrogen bond acceptor count of the compound is 8.
The compound has 7 rotatable bonds.
The exact mass of the compound is 832.092882 g/mol.
The topological polar surface area of the compound is 112?2.
The compound contains 53 heavy atoms.