(S)-BoroPro-(-)-Pinanediol-HCl

• CAS: 149716-73-4
• Catalog Number: ACM149716734
• Category: Boro-Amino Acids
• Molecular Weight: 285.62
• Molecular Formula: C₁₄H₂₅BClNO₂
• Synonyms: (S)-BoroPro-(-)-Pinanediol-HCl;(S)-BoroPro-(-)-Pinanediol-hydrochloride;(S)-2-Pyrrolidineboronic acid pinanediol ester hydrochloride;(1R,2R,3S,5R)-Pinanediol Pyrrolidine-2S-boronate Hydrochloride

Custom Q&A

What is the molecular formula of (S)-BoroPro-(-)-Pinanediol-HCl?

The molecular formula is C14H25BClNO2.

What is the PubChem CID of (S)-BoroPro-(-)-Pinanediol-HCl?

The PubChem CID is 49853524.

What is the molecular weight of (S)-BoroPro-(-)-Pinanediol-HCl?

The molecular weight is 285.62 g/mol.

What is the IUPAC name of (S)-BoroPro-(-)-Pinanediol-HCl?

The IUPAC name is (2S)-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine hydrochloride.

What is the InChI of (S)-BoroPro-(-)-Pinanediol-HCl?

The InChI is InChI=1S/C14H24BNO2.ClH/c1-13(2)9-7-10(13)14(3)11(8-9)17-15(18-14)12-5-4-6-16-12;/h9-12,16H,4-8H2,1-3H3;1H/t9-,10-,11+,12-,14-;/m1./s1.

What is the Canonical SMILES of (S)-BoroPro-(-)-Pinanediol-HCl?

The Canonical SMILES is B1(OC2CC3CC(C3(C)C)C2(O1)C)C4CCCN4.Cl.

What is the CAS number of (S)-BoroPro-(-)-Pinanediol-HCl?

The CAS number is 149716-73-4.

What is the hydrogen bond donor count of (S)-BoroPro-(-)-Pinanediol-HCl?

The hydrogen bond donor count is 2.

What is the hydrogen bond acceptor count of (S)-BoroPro-(-)-Pinanediol-HCl?

The hydrogen bond acceptor count is 3.

Is (S)-BoroPro-(-)-Pinanediol-HCl a canonicalized compound?

Yes, (S)-BoroPro-(-)-Pinanediol-HCl is canonicalized.